Search

Your search keyword '"Zhiying Huang"' showing total 6 results

Search Constraints

Start Over You searched for: Author "Zhiying Huang" Remove constraint Author: "Zhiying Huang" Publisher royal society of chemistry (rsc) Remove constraint Publisher: royal society of chemistry (rsc)
6 results on '"Zhiying Huang"'

Search Results

1. Syntheses and structural characterizations of a series of Mo(W)–Cu–S compounds of bidentate dialkyldithiocarbamate ligands. Crystal structure of [NEt4]2[Mo2Cu5S6O2(Me2NCS2)3]

2. Recognition and neutralization of angiotensins I and II using an artificial nanogel receptor fabricated by ligand specificity determinant imprinting

3. A quindecanuclear nickel–sulphur cluster: synthesis and crystal structure of Ni15(µ3-S)6(µ4-S)9(PPh3)6

4. Synthesis and crystal structure of a square planar tetra-cobalt complex with two quadruply-bridging sulphur atoms [(η5-Cp)4Co4(µ4-S)2]

5. Stereochemistry of mixed thiolate and ditertiary phosphine cobalt(II) complexes. Crystal structures of [Co{Ph2P(CH2)3PPh2}(SPh)2] and [Co{Ph2PCH2CH2P(Ph)CH2CH2PPh2}(SPh)2]

6. Synthesis and X-ray structure of an asymmetrical dicobalt(<scp>II</scp>) complex Co2(dppe)(µ-SPh)3SPh (dppe = Ph2PCH2CH2PPh2)

Catalog

Books, media, physical & digital resources