Slow Magnetic Relaxation in One-Dimensional Azido-Bridged CoII Complexes

Crystal structures and magnetic properties of three one-dimensional (1D) azido-bridged cobalt(II) chains with different amide ligands (L), [Co2(N3)4(DMF)3] (1), [Co4(N3)8(DEF)5] (2), and [Co2(N3)4(DIPF)2] (3) (DMF = N,N-dimethylformamide, DEF = N,N-diethylformamide, and DIPF = N,N-diisopropylformamide), are reported to investigate the influence of L on their structures and magnetic properties. Single-crystal X-ray crystallographic analysis revealed that, although 1–3 all consist of cobalt chains bridged by end-on (EO) azides, the coordination geometry of the CoII ions and the repeating units of the 1D structures are quite different. As the size of L increases, the ratio of L to CoII decreases from 6:4 in 1 to 5:4 and 4:4 in 2 and 3, respectively. In 1, two [CoN5O1] and two [CoN4O2] distorted octahedra form the {[CoN5O1][CoN4O2]2[CoN5O1]} tetramers (denoted as Co4A), which are linked to each other by sharing the N–N edge to form the chain. Similarly, the chain structure of 3 is constructed from a similar t...